C21H33N3O3S2 — CID 51958561
4-[(2R)-2-benzylsulfanylpropanoyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide (PubChem CID 51958561) has the molecular formula C21H33N3O3S2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 4-[(2R)-2-benzylsulfanylpropanoyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide.
| Compound Name | 4-[(2R)-2-benzylsulfanylpropanoyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 51958561 |
| Molecular Formula | C21H33N3O3S2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-[(2R)-2-benzylsulfanylpropanoyl]-N-cyclohexyl-N-methylpiperazine-1-sulfonamide |
| SMILES | C[C@@H](SCc1ccccc1)C(=O)N1CCN(S(=O)(=O)N(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H33N3O3S2/c1-18(28-17-19-9-5-3-6-10-19)21(25)23-13-15-24(16-14-23)29(26,27)22(2)20-11-7-4-8-12-20/h3,5-6,9-10,18,20H,4,7-8,11-17H2,1-2H3/t18-/m1/s1 |
| InChIKey | CWJGLTGMWRTKMF-GOSISDBHSA-N |
| XLogP | 2.96 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |