C16H23NOS — CID 92662149
(2R)-2-benzylsulfanyl-1-(4-methylpiperidin-1-yl)propan-1-one (PubChem CID 92662149) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is (2R)-2-benzylsulfanyl-1-(4-methylpiperidin-1-yl)propan-1-one.
| Compound Name | (2R)-2-benzylsulfanyl-1-(4-methylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 92662149 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (2R)-2-benzylsulfanyl-1-(4-methylpiperidin-1-yl)propan-1-one |
| SMILES | CC1CCN(C(=O)[C@@H](C)SCc2ccccc2)CC1 |
| InChI | InChI=1S/C16H23NOS/c1-13-8-10-17(11-9-13)16(18)14(2)19-12-15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | REFGQUMPKCJMHM-CQSZACIVSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |