C18H27N3OS — CID 120997771
2-benzylsulfanyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one (PubChem CID 120997771) has the molecular formula C18H27N3OS and a molecular weight of 333.50 g/mol. Its IUPAC name is 2-benzylsulfanyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 2-benzylsulfanyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 120997771 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-benzylsulfanyl-1-(3-piperazin-1-ylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC(SCc1ccccc1)C(=O)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C18H27N3OS/c1-15(23-14-16-5-3-2-4-6-16)18(22)21-10-7-17(13-21)20-11-8-19-9-12-20/h2-6,15,17,19H,7-14H2,1H3 |
| InChIKey | ORKMKJAMKCFVAO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |