C19H28ClN3O — CID 120996210
(1-benzylcyclopropyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120996210) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is (1-benzylcyclopropyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (1-benzylcyclopropyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120996210 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | (1-benzylcyclopropyl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(N1CCC(N2CCNCC2)C1)C1(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O.ClH/c23-18(19(7-8-19)14-16-4-2-1-3-5-16)22-11-6-17(15-22)21-12-9-20-10-13-21;/h1-5,17,20H,6-15H2;1H |
| InChIKey | IDULBESSQQFFOV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |