C17H25N3O2S — CID 94789663
2-[4-[(2R)-2-benzylsulfanylpropanoyl]piperazin-1-yl]-N-methylacetamide (PubChem CID 94789663) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is 2-[4-[(2R)-2-benzylsulfanylpropanoyl]piperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[(2R)-2-benzylsulfanylpropanoyl]piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 94789663 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-[(2R)-2-benzylsulfanylpropanoyl]piperazin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCN(C(=O)[C@@H](C)SCc2ccccc2)CC1 |
| InChI | InChI=1S/C17H25N3O2S/c1-14(23-13-15-6-4-3-5-7-15)17(22)20-10-8-19(9-11-20)12-16(21)18-2/h3-7,14H,8-13H2,1-2H3,(H,18,21)/t14-/m1/s1 |
| InChIKey | QJKNWWSEWQLKAB-CQSZACIVSA-N |
| XLogP | 1.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |