C20H23FN2O3S2 — CID 55770764
2-benzylsulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 55770764) has the molecular formula C20H23FN2O3S2 and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-benzylsulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | 2-benzylsulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 55770764 |
| Molecular Formula | C20H23FN2O3S2 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-benzylsulfanyl-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | CC(SCc1ccccc1)C(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H23FN2O3S2/c1-16(27-15-17-7-3-2-4-8-17)20(24)22-11-13-23(14-12-22)28(25,26)19-10-6-5-9-18(19)21/h2-10,16H,11-15H2,1H3 |
| InChIKey | CPNWPYNBYSKRBR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |