C16H22FN3O3S — CID 17449698
N-(1-cyclopropylethyl)-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 17449698) has the molecular formula C16H22FN3O3S and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-(1-cyclopropylethyl)-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 17449698 |
| Molecular Formula | C16H22FN3O3S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N-(1-cyclopropylethyl)-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | CC(NC(=O)N1CCN(S(=O)(=O)c2ccccc2F)CC1)C1CC1 |
| InChI | InChI=1S/C16H22FN3O3S/c1-12(13-6-7-13)18-16(21)19-8-10-20(11-9-19)24(22,23)15-5-3-2-4-14(15)17/h2-5,12-13H,6-11H2,1H3,(H,18,21) |
| InChIKey | LZAAVWCAVQDLQB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |