C18H27FN3O3S+ — CID 8512706
(2R)-N-cyclopentyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide (PubChem CID 8512706) has the molecular formula C18H27FN3O3S+ and a molecular weight of 384.50 g/mol. Its IUPAC name is (2R)-N-cyclopentyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-cyclopentyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8512706 |
| Molecular Formula | C18H27FN3O3S+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2R)-N-cyclopentyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC1CCCC1)[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN3O3S/c1-14(18(23)20-15-6-2-3-7-15)21-10-12-22(13-11-21)26(24,25)17-9-5-4-8-16(17)19/h4-5,8-9,14-15H,2-3,6-7,10-13H2,1H3,(H,20,23)/p+1/t14-/m1/s1 |
| InChIKey | JCFIQIJKNVFQFY-CQSZACIVSA-O |
| XLogP | 0.16 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |