C20H31FN3O3S+ — CID 8512708
(2S)-N-cyclohexyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-methylpropanamide (PubChem CID 8512708) has the molecular formula C20H31FN3O3S+ and a molecular weight of 412.55 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-methylpropanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 8512708 |
| Molecular Formula | C20H31FN3O3S+ |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[4-(2-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)C1CCCCC1)[NH+]1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H30FN3O3S/c1-16(20(25)22(2)17-8-4-3-5-9-17)23-12-14-24(15-13-23)28(26,27)19-11-7-6-10-18(19)21/h6-7,10-11,16-17H,3-5,8-9,12-15H2,1-2H3/p+1/t16-/m0/s1 |
| InChIKey | ZPBYDEIGCCTIAT-INIZCTEOSA-O |
| XLogP | 0.89 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |