C19H31N4O5S+ — CID 9493089
(2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N,N-di(propan-2-yl)propanamide (PubChem CID 9493089) has the molecular formula C19H31N4O5S+ and a molecular weight of 427.55 g/mol. Its IUPAC name is (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N,N-di(propan-2-yl)propanamide.
| Compound Name | (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N,N-di(propan-2-yl)propanamide |
|---|---|
| PubChem CID | 9493089 |
| Molecular Formula | C19H31N4O5S+ |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N,N-di(propan-2-yl)propanamide |
| SMILES | CC(C)N(C(=O)[C@H](C)[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1)C(C)C |
| InChI | InChI=1S/C19H30N4O5S/c1-14(2)22(15(3)4)19(24)16(5)20-10-12-21(13-11-20)29(27,28)18-9-7-6-8-17(18)23(25)26/h6-9,14-16H,10-13H2,1-5H3/p+1/t16-/m0/s1 |
| InChIKey | XOOXFEMBWCJULV-INIZCTEOSA-O |
| XLogP | 0.52 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|