C19H23N4O5S+ — CID 8512444
(2R)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide (PubChem CID 8512444) has the molecular formula C19H23N4O5S+ and a molecular weight of 419.48 g/mol. Its IUPAC name is (2R)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide.
| Compound Name | (2R)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 8512444 |
| Molecular Formula | C19H23N4O5S+ |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-phenylpropanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1)[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H22N4O5S/c1-15(19(24)20-16-7-3-2-4-8-16)21-11-13-22(14-12-21)29(27,28)18-10-6-5-9-17(18)23(25)26/h2-10,15H,11-14H2,1H3,(H,20,24)/p+1/t15-/m1/s1 |
| InChIKey | ZUAPZBUTLAXZET-OAHLLOKOSA-O |
| XLogP | 0.51 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|