C25H27N4O5S+ — CID 2690486
(2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide (PubChem CID 2690486) has the molecular formula C25H27N4O5S+ and a molecular weight of 495.58 g/mol. Its IUPAC name is (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide.
| Compound Name | (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide |
|---|---|
| PubChem CID | 2690486 |
| Molecular Formula | C25H27N4O5S+ |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (2S)-2-[4-(2-nitrophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-phenylphenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1-c1ccccc1)[NH+]1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C25H26N4O5S/c1-19(25(30)26-22-12-6-5-11-21(22)20-9-3-2-4-10-20)27-15-17-28(18-16-27)35(33,34)24-14-8-7-13-23(24)29(31)32/h2-14,19H,15-18H2,1H3,(H,26,30)/p+1/t19-/m0/s1 |
| InChIKey | MUDQVZSFVAKIAO-IBGZPJMESA-O |
| XLogP | 2.18 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|