C14H22N4O3+2 — CID 8896324
(2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-N-(2-nitrophenyl)propanamide (PubChem CID 8896324) has the molecular formula C14H22N4O3+2 and a molecular weight of 294.35 g/mol. Its IUPAC name is (2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-N-(2-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 8896324 |
| Molecular Formula | C14H22N4O3+2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S)-2-(4-methylpiperazine-1,4-diium-1-yl)-N-(2-nitrophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccccc1[N+](=O)[O-])[NH+]1CC[NH+](C)CC1 |
| InChI | InChI=1S/C14H20N4O3/c1-11(17-9-7-16(2)8-10-17)14(19)15-12-5-3-4-6-13(12)18(20)21/h3-6,11H,7-10H2,1-2H3,(H,15,19)/p+2/t11-/m0/s1 |
| InChIKey | PHRPBVQBPDXVGX-NSHDSACASA-P |
| XLogP | -1.66 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|