C20H25N4O5+ — CID 9432557
(2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide (PubChem CID 9432557) has the molecular formula C20H25N4O5+ and a molecular weight of 401.44 g/mol. Its IUPAC name is (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 9432557 |
| Molecular Formula | C20H25N4O5+ |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (2R)-2-[4-(2-hydroxyphenyl)piperazin-1-ium-1-yl]-N-(4-methoxy-2-nitrophenyl)propanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](C)[NH+]2CCN(c3ccccc3O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H24N4O5/c1-14(20(26)21-16-8-7-15(29-2)13-18(16)24(27)28)22-9-11-23(12-10-22)17-5-3-4-6-19(17)25/h3-8,13-14,25H,9-12H2,1-2H3,(H,21,26)/p+1/t14-/m1/s1 |
| InChIKey | AHGGWXGXMRAWFD-CQSZACIVSA-O |
| XLogP | 1.04 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|