C21H27N4O4+ — CID 8725383
(2R)-N-(2-methoxy-4-nitrophenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 8725383) has the molecular formula C21H27N4O4+ and a molecular weight of 399.47 g/mol. Its IUPAC name is (2R)-N-(2-methoxy-4-nitrophenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 8725383 |
| Molecular Formula | C21H27N4O4+ |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2R)-N-(2-methoxy-4-nitrophenyl)-2-[4-(2-methylphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@@H](C)[NH+]1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C21H26N4O4/c1-15-6-4-5-7-19(15)24-12-10-23(11-13-24)16(2)21(26)22-18-9-8-17(25(27)28)14-20(18)29-3/h4-9,14,16H,10-13H2,1-3H3,(H,22,26)/p+1/t16-/m1/s1 |
| InChIKey | AVVFCRMFQMZNLX-MRXNPFEDSA-O |
| XLogP | 1.64 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|