C19H28N3O4+ — CID 11940336
(2S)-2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxy-4-nitrophenyl)propanamide (PubChem CID 11940336) has the molecular formula C19H28N3O4+ and a molecular weight of 362.45 g/mol. Its IUPAC name is (2S)-2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxy-4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxy-4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 11940336 |
| Molecular Formula | C19H28N3O4+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2S)-2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]-N-(2-methoxy-4-nitrophenyl)propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)[NH+]1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H27N3O4/c1-13(21-10-9-14-5-3-4-6-15(14)12-21)19(23)20-17-8-7-16(22(24)25)11-18(17)26-2/h7-8,11,13-15H,3-6,9-10,12H2,1-2H3,(H,20,23)/p+1/t13-,14-,15+/m0/s1 |
| InChIKey | OPSRLCUZOPDGKY-SOUVJXGZSA-O |
| XLogP | 2.03 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|