C19H25N4O4+ — CID 11935303
(2S)-N-(2-methoxy-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]propanamide (PubChem CID 11935303) has the molecular formula C19H25N4O4+ and a molecular weight of 373.43 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]propanamide.
| Compound Name | (2S)-N-(2-methoxy-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 11935303 |
| Molecular Formula | C19H25N4O4+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (2S)-N-(2-methoxy-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]propanamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)[C@H](C)[NH+]1CCC[C@@H]1c1cccn1C |
| InChI | InChI=1S/C19H24N4O4/c1-13(22-11-5-7-17(22)16-6-4-10-21(16)2)19(24)20-15-9-8-14(23(25)26)12-18(15)27-3/h4,6,8-10,12-13,17H,5,7,11H2,1-3H3,(H,20,24)/p+1/t13-,17+/m0/s1 |
| InChIKey | XALSKMOMUIJARM-SUMWQHHRSA-O |
| XLogP | 1.69 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|