C14H20N3O4+ — CID 7815568
(2S)-N-(2-methoxy-5-nitrophenyl)-2-pyrrolidin-1-ium-1-ylpropanamide (PubChem CID 7815568) has the molecular formula C14H20N3O4+ and a molecular weight of 294.33 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-5-nitrophenyl)-2-pyrrolidin-1-ium-1-ylpropanamide.
| Compound Name | (2S)-N-(2-methoxy-5-nitrophenyl)-2-pyrrolidin-1-ium-1-ylpropanamide |
|---|---|
| PubChem CID | 7815568 |
| Molecular Formula | C14H20N3O4+ |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (2S)-N-(2-methoxy-5-nitrophenyl)-2-pyrrolidin-1-ium-1-ylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+]1CCCC1 |
| InChI | InChI=1S/C14H19N3O4/c1-10(16-7-3-4-8-16)14(18)15-12-9-11(17(19)20)5-6-13(12)21-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,15,18)/p+1/t10-/m0/s1 |
| InChIKey | MPDRDTXAQJXDFM-JTQLQIEISA-O |
| XLogP | 0.61 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|