C15H18N2O6 — CID 24687066
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate (PubChem CID 24687066) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 24687066 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)OC(=O)C1CCC1 |
| InChI | InChI=1S/C15H18N2O6/c1-9(23-15(19)10-4-3-5-10)14(18)16-12-8-11(17(20)21)6-7-13(12)22-2/h6-10H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | VOWOQFMMIHTTKB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|