C15H16Cl2N2O6 — CID 2585873
[(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2585873) has the molecular formula C15H16Cl2N2O6 and a molecular weight of 391.21 g/mol. Its IUPAC name is [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2585873 |
| Molecular Formula | C15H16Cl2N2O6 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | [(2R)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] (1R)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)OC(=O)[C@@]1(C)CC1(Cl)Cl |
| InChI | InChI=1S/C15H16Cl2N2O6/c1-8(25-13(21)14(2)7-15(14,16)17)12(20)18-10-6-9(19(22)23)4-5-11(10)24-3/h4-6,8H,7H2,1-3H3,(H,18,20)/t8-,14-/m1/s1 |
| InChIKey | XXJZPUWPNBNUFA-XLKFXECMSA-N |
| XLogP | 3.06 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|