C14H13Cl3N2O5 — CID 4527386
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 4527386) has the molecular formula C14H13Cl3N2O5 and a molecular weight of 395.63 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 4527386 |
| Molecular Formula | C14H13Cl3N2O5 |
| Molecular Weight | 395.63 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC(OC(=O)C1(C)CC1(Cl)Cl)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C14H13Cl3N2O5/c1-7(24-12(21)13(2)6-14(13,16)17)11(20)18-10-5-8(19(22)23)3-4-9(10)15/h3-5,7H,6H2,1-2H3,(H,18,20) |
| InChIKey | OKAGPDDCLHYSIU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|