C16H18N2O6 — CID 5052866
[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate (PubChem CID 5052866) has the molecular formula C16H18N2O6 and a molecular weight of 334.33 g/mol. Its IUPAC name is [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate.
| Compound Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate |
|---|---|
| PubChem CID | 5052866 |
| Molecular Formula | C16H18N2O6 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | [1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] hexa-2,4-dienoate |
| SMILES | CC=CC=CC(=O)OC(C)C(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C16H18N2O6/c1-4-5-6-7-15(19)24-11(2)16(20)17-13-10-12(18(21)22)8-9-14(13)23-3/h4-11H,1-3H3,(H,17,20) |
| InChIKey | NKIJRCWIAYNSNQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|