C21H24N3O4+ — CID 8512960
(2S)-N-(2-methoxy-5-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)propanamide (PubChem CID 8512960) has the molecular formula C21H24N3O4+ and a molecular weight of 382.44 g/mol. Its IUPAC name is (2S)-N-(2-methoxy-5-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)propanamide.
| Compound Name | (2S)-N-(2-methoxy-5-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8512960 |
| Molecular Formula | C21H24N3O4+ |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2S)-N-(2-methoxy-5-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)[NH+]1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N3O4/c1-15(23-12-10-17(11-13-23)16-6-4-3-5-7-16)21(25)22-19-14-18(24(26)27)8-9-20(19)28-2/h3-10,14-15H,11-13H2,1-2H3,(H,22,25)/p+1/t15-/m0/s1 |
| InChIKey | WAMVOEDMCGYSKR-HNNXBMFYSA-O |
| XLogP | 2.30 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|