C19H20N6O4 — CID 47069830
N-(2-methoxy-5-nitrophenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 47069830) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 47069830 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-3-methyl-2-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C(C)C)n1nnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H20N6O4/c1-12(2)17(24-22-18(21-23-24)13-7-5-4-6-8-13)19(26)20-15-11-14(25(27)28)9-10-16(15)29-3/h4-12,17H,1-3H3,(H,20,26) |
| InChIKey | JYDKEMLBGVOCKX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|