C19H25N4O4+ — CID 8973030
N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide (PubChem CID 8973030) has the molecular formula C19H25N4O4+ and a molecular weight of 373.43 g/mol. Its IUPAC name is N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide.
| Compound Name | N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8973030 |
| Molecular Formula | C19H25N4O4+ |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-(5-methoxy-2-methyl-4-nitrophenyl)-2-[(2R)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-ium-1-yl]acetamide |
| SMILES | COc1cc(NC(=O)C[NH+]2CCC[C@@H]2c2cccn2C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O4/c1-13-10-17(23(25)26)18(27-3)11-14(13)20-19(24)12-22-9-5-7-16(22)15-6-4-8-21(15)2/h4,6,8,10-11,16H,5,7,9,12H2,1-3H3,(H,20,24)/p+1/t16-/m1/s1 |
| InChIKey | GJPZAIUFRBUWCG-MRXNPFEDSA-O |
| XLogP | 1.61 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|