C18H26N3O6+ — CID 8931511
ethyl 1-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate (PubChem CID 8931511) has the molecular formula C18H26N3O6+ and a molecular weight of 380.42 g/mol. Its IUPAC name is ethyl 1-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 8931511 |
| Molecular Formula | C18H26N3O6+ |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | ethyl 1-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](CC(=O)Nc2cc(OC)c([N+](=O)[O-])cc2C)CC1 |
| InChI | InChI=1S/C18H25N3O6/c1-4-27-18(23)13-5-7-20(8-6-13)11-17(22)19-14-10-16(26-3)15(21(24)25)9-12(14)2/h9-10,13H,4-8,11H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | WGFZPIQELDKSKW-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|