C17H26N3O6+ — CID 7873682
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]azanium (PubChem CID 7873682) has the molecular formula C17H26N3O6+ and a molecular weight of 368.41 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]azanium.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]azanium |
|---|---|
| PubChem CID | 7873682 |
| Molecular Formula | C17H26N3O6+ |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-[(2S,3R)-1-methoxy-3-methyl-1-oxopentan-2-yl]azanium |
| SMILES | CC[C@@H](C)C([NH2+]CC(=O)Nc1cc(OC)c([N+](=O)[O-])cc1C)C(=O)OC |
| InChI | InChI=1S/C17H25N3O6/c1-6-10(2)16(17(22)26-5)18-9-15(21)19-12-8-14(25-4)13(20(23)24)7-11(12)3/h7-8,10,16,18H,6,9H2,1-5H3,(H,19,21)/p+1/t10-,16?/m1/s1 |
| InChIKey | PHSSIMDRNWOPGQ-HQNRFAHOSA-O |
| XLogP | 1.00 |
| TPSA | 124.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|