C19H18Cl2N2O7 — CID 41117332
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 41117332) has the molecular formula C19H18Cl2N2O7 and a molecular weight of 457.27 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 41117332 |
| Molecular Formula | C19H18Cl2N2O7 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl] (2R)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | COc1cc(NC(=O)COC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18Cl2N2O7/c1-10-6-15(23(26)27)17(28-3)8-14(10)22-18(24)9-29-19(25)11(2)30-16-5-4-12(20)7-13(16)21/h4-8,11H,9H2,1-3H3,(H,22,24)/t11-/m1/s1 |
| InChIKey | PYXSMYYHUWIIFT-LLVKDONJSA-N |
| XLogP | 4.17 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|