C17H27N4O5+ — CID 8756805
[2-(tert-butylamino)-2-oxoethyl]-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8756805) has the molecular formula C17H27N4O5+ and a molecular weight of 367.43 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8756805 |
| Molecular Formula | C17H27N4O5+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cc(NC(=O)C[NH+](C)CC(=O)NC(C)(C)C)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H26N4O5/c1-11-7-13(21(24)25)14(26-6)8-12(11)18-15(22)9-20(5)10-16(23)19-17(2,3)4/h7-8H,9-10H2,1-6H3,(H,18,22)(H,19,23)/p+1 |
| InChIKey | VATQMGGPYIEHJN-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|