C21H26N3O5+ — CID 9168123
[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium (PubChem CID 9168123) has the molecular formula C21H26N3O5+ and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium.
| Compound Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9168123 |
| Molecular Formula | C21H26N3O5+ |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methyl-[(4-prop-2-enoxyphenyl)methyl]azanium |
| SMILES | C=CCOc1ccc(C[NH+](C)CC(=O)Nc2cc(OC)c([N+](=O)[O-])cc2C)cc1 |
| InChI | InChI=1S/C21H25N3O5/c1-5-10-29-17-8-6-16(7-9-17)13-23(3)14-21(25)22-18-12-20(28-4)19(24(26)27)11-15(18)2/h5-9,11-12H,1,10,13-14H2,2-4H3,(H,22,25)/p+1 |
| InChIKey | CMZCETJMBZTMAS-UHFFFAOYSA-O |
| XLogP | 2.13 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|