C21H28N3O5+ — CID 8798663
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium (PubChem CID 8798663) has the molecular formula C21H28N3O5+ and a molecular weight of 402.47 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8798663 |
| Molecular Formula | C21H28N3O5+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-[(4-ethoxy-3-methoxyphenyl)methyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)Nc2cc(C)c(C)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H27N3O5/c1-6-29-19-8-7-16(11-20(19)28-5)12-23(4)13-21(25)22-17-9-14(2)15(3)10-18(17)24(26)27/h7-11H,6,12-13H2,1-5H3,(H,22,25)/p+1 |
| InChIKey | XPOKBNAPAADLHV-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|