C22H31N2O3+ — CID 8798352
(4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium (PubChem CID 8798352) has the molecular formula C22H31N2O3+ and a molecular weight of 371.50 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8798352 |
| Molecular Formula | C22H31N2O3+ |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)Nc2ccc(C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C22H30N2O3/c1-6-27-20-12-7-17(13-21(20)26-5)14-24(4)15-22(25)23-19-10-8-18(9-11-19)16(2)3/h7-13,16H,6,14-15H2,1-5H3,(H,23,25)/p+1 |
| InChIKey | SELYRAAPAVIPLY-UHFFFAOYSA-O |
| XLogP | 2.87 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |