C19H24FN2O3+ — CID 9266861
[2-(4-ethoxyanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium (PubChem CID 9266861) has the molecular formula C19H24FN2O3+ and a molecular weight of 347.41 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9266861 |
| Molecular Formula | C19H24FN2O3+ |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl]-[(3-fluoro-4-methoxyphenyl)methyl]-methylazanium |
| SMILES | CCOc1ccc(NC(=O)C[NH+](C)Cc2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C19H23FN2O3/c1-4-25-16-8-6-15(7-9-16)21-19(23)13-22(2)12-14-5-10-18(24-3)17(20)11-14/h5-11H,4,12-13H2,1-3H3,(H,21,23)/p+1 |
| InChIKey | JZSXGCFDJTYDOQ-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |