C20H25N2O4+ — CID 8799417
(4-ethoxyphenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium (PubChem CID 8799417) has the molecular formula C20H25N2O4+ and a molecular weight of 357.43 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (4-ethoxyphenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8799417 |
| Molecular Formula | C20H25N2O4+ |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (4-ethoxyphenyl)methyl-[2-(4-methoxycarbonylanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)Nc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-4-26-18-11-5-15(6-12-18)13-22(2)14-19(23)21-17-9-7-16(8-10-17)20(24)25-3/h5-12H,4,13-14H2,1-3H3,(H,21,23)/p+1 |
| InChIKey | VMEGMURCBORISX-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 69.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |