C25H28N3O3+ — CID 9003143
methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium (PubChem CID 9003143) has the molecular formula C25H28N3O3+ and a molecular weight of 418.52 g/mol. Its IUPAC name is methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium.
| Compound Name | methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9003143 |
| Molecular Formula | C25H28N3O3+ |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)CC(=O)Nc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c1-26-25(30)21-10-8-19(9-11-21)16-28(2)17-24(29)27-22-12-14-23(15-13-22)31-18-20-6-4-3-5-7-20/h3-15H,16-18H2,1-2H3,(H,26,30)(H,27,29)/p+1 |
| InChIKey | AGOFDHILFNGFOG-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |