C19H24N3O3+ — CID 9003149
[2-(3-methoxyanilino)-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium (PubChem CID 9003149) has the molecular formula C19H24N3O3+ and a molecular weight of 342.42 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 9003149 |
| Molecular Formula | C19H24N3O3+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[[4-(methylcarbamoyl)phenyl]methyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)CC(=O)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-20-19(24)15-9-7-14(8-10-15)12-22(2)13-18(23)21-16-5-4-6-17(11-16)25-3/h4-11H,12-13H2,1-3H3,(H,20,24)(H,21,23)/p+1 |
| InChIKey | MEFOGQXOMDMLFZ-UHFFFAOYSA-O |
| XLogP | 0.71 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |