C24H26N3O3+ — CID 9003305
methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium (PubChem CID 9003305) has the molecular formula C24H26N3O3+ and a molecular weight of 404.49 g/mol. Its IUPAC name is methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium.
| Compound Name | methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9003305 |
| Molecular Formula | C24H26N3O3+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | methyl-[[4-(methylcarbamoyl)phenyl]methyl]-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium |
| SMILES | CNC(=O)c1ccc(C[NH+](C)CC(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-25-24(29)19-10-8-18(9-11-19)16-27(2)17-23(28)26-20-12-14-22(15-13-20)30-21-6-4-3-5-7-21/h3-15H,16-17H2,1-2H3,(H,25,29)(H,26,28)/p+1 |
| InChIKey | GFXYBSHVLSJVOE-UHFFFAOYSA-O |
| XLogP | 2.49 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |