C23H23FN3O3+ — CID 7999133
[2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium (PubChem CID 7999133) has the molecular formula C23H23FN3O3+ and a molecular weight of 408.45 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium |
|---|---|
| PubChem CID | 7999133 |
| Molecular Formula | C23H23FN3O3+ |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl]-methyl-[2-oxo-2-(4-phenoxyanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)cc1)CC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22FN3O3/c1-27(15-22(28)25-18-9-7-17(24)8-10-18)16-23(29)26-19-11-13-21(14-12-19)30-20-5-3-2-4-6-20/h2-14H,15-16H2,1H3,(H,25,28)(H,26,29)/p+1 |
| InChIKey | WBYUFHOUMYIYFJ-UHFFFAOYSA-O |
| XLogP | 2.71 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |