C22H22FN2O2+ — CID 9251939
(4-fluorophenyl)methyl-methyl-[2-oxo-2-(2-phenoxyanilino)ethyl]azanium (PubChem CID 9251939) has the molecular formula C22H22FN2O2+ and a molecular weight of 365.43 g/mol. Its IUPAC name is (4-fluorophenyl)methyl-methyl-[2-oxo-2-(2-phenoxyanilino)ethyl]azanium.
| Compound Name | (4-fluorophenyl)methyl-methyl-[2-oxo-2-(2-phenoxyanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9251939 |
| Molecular Formula | C22H22FN2O2+ |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (4-fluorophenyl)methyl-methyl-[2-oxo-2-(2-phenoxyanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccccc1Oc1ccccc1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c1-25(15-17-11-13-18(23)14-12-17)16-22(26)24-20-9-5-6-10-21(20)27-19-7-3-2-4-8-19/h2-14H,15-16H2,1H3,(H,24,26)/p+1 |
| InChIKey | FVKAJVDMALJFET-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |