C19H20FN4O2+ — CID 9040901
[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9040901) has the molecular formula C19H20FN4O2+ and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9040901 |
| Molecular Formula | C19H20FN4O2+ |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)cc1)CC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H19FN4O2/c1-24(13-19(26)23-17-8-4-15(20)5-9-17)12-18(25)22-16-6-2-14(3-7-16)10-11-21/h2-9H,10,12-13H2,1H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | JXOYTEUWKINDNR-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |