C19H22FN4O3+ — CID 9253430
[2-(4-acetamidoanilino)-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium (PubChem CID 9253430) has the molecular formula C19H22FN4O3+ and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9253430 |
| Molecular Formula | C19H22FN4O3+ |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-[2-(4-fluoroanilino)-2-oxoethyl]-methylazanium |
| SMILES | CC(=O)Nc1ccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H21FN4O3/c1-13(25)21-15-7-9-17(10-8-15)23-19(27)12-24(2)11-18(26)22-16-5-3-14(20)4-6-16/h3-10H,11-12H2,1-2H3,(H,21,25)(H,22,26)(H,23,27)/p+1 |
| InChIKey | FTCRXOHIBMESKN-UHFFFAOYSA-O |
| XLogP | 0.88 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |