C13H20N3O2+ — CID 9254626
[2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-methylazanium (PubChem CID 9254626) has the molecular formula C13H20N3O2+ and a molecular weight of 250.32 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-methylazanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 9254626 |
| Molecular Formula | C13H20N3O2+ |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-methylazanium |
| SMILES | CC[NH+](C)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C13H19N3O2/c1-4-16(3)9-13(18)15-12-7-5-11(6-8-12)14-10(2)17/h5-8H,4,9H2,1-3H3,(H,14,17)(H,15,18)/p+1 |
| InChIKey | PXAMETOETBFRQE-UHFFFAOYSA-O |
| XLogP | 0.12 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |