C20H25FN3O2+ — CID 8791369
[2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(1S)-1-(4-fluorophenyl)ethyl]azanium (PubChem CID 8791369) has the molecular formula C20H25FN3O2+ and a molecular weight of 358.44 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(1S)-1-(4-fluorophenyl)ethyl]azanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(1S)-1-(4-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 8791369 |
| Molecular Formula | C20H25FN3O2+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(1S)-1-(4-fluorophenyl)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(NC(C)=O)cc1)[C@@H](C)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H24FN3O2/c1-4-24(14(2)16-5-7-17(21)8-6-16)13-20(26)23-19-11-9-18(10-12-19)22-15(3)25/h5-12,14H,4,13H2,1-3H3,(H,22,25)(H,23,26)/p+1/t14-/m0/s1 |
| InChIKey | MZFDVYQHSJXKKI-AWEZNQCLSA-O |
| XLogP | 2.39 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |