C17H27N4O3+ — CID 8791503
[2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium (PubChem CID 8791503) has the molecular formula C17H27N4O3+ and a molecular weight of 335.43 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 8791503 |
| Molecular Formula | C17H27N4O3+ |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-ethyl-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CCNC(=O)[C@H](C)[NH+](CC)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H26N4O3/c1-5-18-17(24)12(3)21(6-2)11-16(23)20-15-9-7-14(8-10-15)19-13(4)22/h7-10,12H,5-6,11H2,1-4H3,(H,18,24)(H,19,22)(H,20,23)/p+1/t12-/m0/s1 |
| InChIKey | YZECSHMBRXIEKE-LBPRGKRZSA-O |
| XLogP | 0.01 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |