C22H28N5O4+ — CID 8780086
bis[2-(4-acetamidoanilino)-2-oxoethyl]-ethylazanium (PubChem CID 8780086) has the molecular formula C22H28N5O4+ and a molecular weight of 426.50 g/mol. Its IUPAC name is bis[2-(4-acetamidoanilino)-2-oxoethyl]-ethylazanium.
| Compound Name | bis[2-(4-acetamidoanilino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8780086 |
| Molecular Formula | C22H28N5O4+ |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | bis[2-(4-acetamidoanilino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(NC(C)=O)cc1)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C22H27N5O4/c1-4-27(13-21(30)25-19-9-5-17(6-10-19)23-15(2)28)14-22(31)26-20-11-7-18(8-12-20)24-16(3)29/h5-12H,4,13-14H2,1-3H3,(H,23,28)(H,24,29)(H,25,30)(H,26,31)/p+1 |
| InChIKey | PPGDSFANHXTAHR-UHFFFAOYSA-O |
| XLogP | 1.09 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |