C18H28N3O3+ — CID 8796493
[2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium (PubChem CID 8796493) has the molecular formula C18H28N3O3+ and a molecular weight of 334.44 g/mol. Its IUPAC name is [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8796493 |
| Molecular Formula | C18H28N3O3+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [2-(4-acetylanilino)-2-oxoethyl]-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(C(C)=O)cc1)CC(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H27N3O3/c1-6-21(12-17(24)20-18(3,4)5)11-16(23)19-15-9-7-14(8-10-15)13(2)22/h7-10H,6,11-12H2,1-5H3,(H,19,23)(H,20,24)/p+1 |
| InChIKey | VYLJGOKNRTXKMY-UHFFFAOYSA-O |
| XLogP | 0.65 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |