C14H21N4O3+ — CID 8779879
[2-(4-acetamidoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)-ethylazanium (PubChem CID 8779879) has the molecular formula C14H21N4O3+ and a molecular weight of 293.35 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)-ethylazanium.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)-ethylazanium |
|---|---|
| PubChem CID | 8779879 |
| Molecular Formula | C14H21N4O3+ |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl]-(2-amino-2-oxoethyl)-ethylazanium |
| SMILES | CC[NH+](CC(N)=O)CC(=O)Nc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-3-18(8-13(15)20)9-14(21)17-12-6-4-11(5-7-12)16-10(2)19/h4-7H,3,8-9H2,1-2H3,(H2,15,20)(H,16,19)(H,17,21)/p+1 |
| InChIKey | CROVBPWASHOFJS-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |