C19H25N4O5S+ — CID 2442436
ethyl-[2-(4-methoxyanilino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]azanium (PubChem CID 2442436) has the molecular formula C19H25N4O5S+ and a molecular weight of 421.50 g/mol. Its IUPAC name is ethyl-[2-(4-methoxyanilino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]azanium.
| Compound Name | ethyl-[2-(4-methoxyanilino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 2442436 |
| Molecular Formula | C19H25N4O5S+ |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | ethyl-[2-(4-methoxyanilino)-2-oxoethyl]-[2-oxo-2-(4-sulfamoylanilino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1ccc(OC)cc1)CC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H24N4O5S/c1-3-23(12-18(24)21-14-4-8-16(28-2)9-5-14)13-19(25)22-15-6-10-17(11-7-15)29(20,26)27/h4-11H,3,12-13H2,1-2H3,(H,21,24)(H,22,25)(H2,20,26,27)/p+1 |
| InChIKey | UUHPFZUJAJLFJF-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |