C15H18N4O4S — CID 2487783
N-(4-methoxyphenyl)-2-[2-(4-sulfamoylphenyl)hydrazinyl]acetamide (PubChem CID 2487783) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[2-(4-sulfamoylphenyl)hydrazinyl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[2-(4-sulfamoylphenyl)hydrazinyl]acetamide |
|---|---|
| PubChem CID | 2487783 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[2-(4-sulfamoylphenyl)hydrazinyl]acetamide |
| SMILES | COc1ccc(NC(=O)CNNc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C15H18N4O4S/c1-23-13-6-2-11(3-7-13)18-15(20)10-17-19-12-4-8-14(9-5-12)24(16,21)22/h2-9,17,19H,10H2,1H3,(H,18,20)(H2,16,21,22) |
| InChIKey | XTMPCAZECCUDDS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|