C21H28N3O4+ — CID 9026269
[2-(4-ethoxyanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium (PubChem CID 9026269) has the molecular formula C21H28N3O4+ and a molecular weight of 386.47 g/mol. Its IUPAC name is [2-(4-ethoxyanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(4-ethoxyanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9026269 |
| Molecular Formula | C21H28N3O4+ |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [2-(4-ethoxyanilino)-2-oxoethyl]-ethyl-[2-(3-methoxyanilino)-2-oxoethyl]azanium |
| SMILES | CCOc1ccc(NC(=O)C[NH+](CC)CC(=O)Nc2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C21H27N3O4/c1-4-24(15-21(26)23-17-7-6-8-19(13-17)27-3)14-20(25)22-16-9-11-18(12-10-16)28-5-2/h6-13H,4-5,14-15H2,1-3H3,(H,22,25)(H,23,26)/p+1 |
| InChIKey | LERDXINKDGWESN-UHFFFAOYSA-O |
| XLogP | 1.58 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |